C26H32O3 — CID 101333164
(6aS,9S,10aS)-1-(methoxymethoxy)-6,6,9-trimethyl-3-[(E)-2-phenylethenyl]-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene (PubChem CID 101333164) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is (6aS,9S,10aS)-1-(methoxymethoxy)-6,6,9-trimethyl-3-[(E)-2-phenylethenyl]-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene.
| Compound Name | (6aS,9S,10aS)-1-(methoxymethoxy)-6,6,9-trimethyl-3-[(E)-2-phenylethenyl]-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 101333164 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (6aS,9S,10aS)-1-(methoxymethoxy)-6,6,9-trimethyl-3-[(E)-2-phenylethenyl]-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene |
| SMILES | COCOc1cc(/C=C/c2ccccc2)cc2c1[C@H]1C[C@@H](C)CC[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C26H32O3/c1-18-10-13-22-21(14-18)25-23(28-17-27-4)15-20(16-24(25)29-26(22,2)3)12-11-19-8-6-5-7-9-19/h5-9,11-12,15-16,18,21-22H,10,13-14,17H2,1-4H3/b12-11+/t18-,21-,22-/m0/s1 |
| InChIKey | TTXWXIJFVIWGKK-NMZRIQAESA-N |
| XLogP | 6.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|