C20H28O7 — CID 46899951
(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carboxylic acid (PubChem CID 46899951) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carboxylic acid.
| Compound Name | (6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 46899951 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromene-3-carboxylic acid |
| SMILES | COCOc1cc(C(=O)O)cc2c1[C@@H]1C[C@H](OCOC)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C20H28O7/c1-20(2)15-6-5-13(25-10-23-3)9-14(15)18-16(26-11-24-4)7-12(19(21)22)8-17(18)27-20/h7-8,13-15H,5-6,9-11H2,1-4H3,(H,21,22)/t13-,14-,15-/m1/s1 |
| InChIKey | XFLWTSJJBRZUFP-RBSFLKMASA-N |
| XLogP | 3.41 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|