C28H41NO6 — CID 46900270
6-[[(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]methyl]-2-oxa-6-azatricyclo[3.3.1.13,7]decane (PubChem CID 46900270) has the molecular formula C28H41NO6 and a molecular weight of 487.64 g/mol. Its IUPAC name is 6-[[(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]methyl]-2-oxa-6-azatricyclo[3.3.1.13,7]decane.
| Compound Name | 6-[[(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]methyl]-2-oxa-6-azatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 46900270 |
| Molecular Formula | C28H41NO6 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 6-[[(6aR,9R,10aR)-1,9-bis(methoxymethoxy)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-3-yl]methyl]-2-oxa-6-azatricyclo[3.3.1.13,7]decane |
| SMILES | COCOc1cc(CN2C3CC4CC2CC(C3)O4)cc2c1[C@@H]1C[C@H](OCOC)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C28H41NO6/c1-28(2)24-6-5-20(32-15-30-3)13-23(24)27-25(33-16-31-4)7-17(8-26(27)35-28)14-29-18-9-21-11-19(29)12-22(10-18)34-21/h7-8,18-24H,5-6,9-16H2,1-4H3/t18?,19?,20-,21?,22?,23-,24-/m1/s1 |
| InChIKey | UUTBWTBZNCJHNE-DCNHLDODSA-N |
| XLogP | 4.61 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|