C23H32O4 — CID 57096757
(1-hydroxy-6,6-dimethyl-3-pent-3-en-2-yl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl) propanoate (PubChem CID 57096757) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (1-hydroxy-6,6-dimethyl-3-pent-3-en-2-yl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl) propanoate.
| Compound Name | (1-hydroxy-6,6-dimethyl-3-pent-3-en-2-yl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl) propanoate |
|---|---|
| PubChem CID | 57096757 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (1-hydroxy-6,6-dimethyl-3-pent-3-en-2-yl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl) propanoate |
| SMILES | CC=CC(C)c1cc(O)c2c(c1)OC(C)(C)C1CCC(OC(=O)CC)CC21 |
| InChI | InChI=1S/C23H32O4/c1-6-8-14(3)15-11-19(24)22-17-13-16(26-21(25)7-2)9-10-18(17)23(4,5)27-20(22)12-15/h6,8,11-12,14,16-18,24H,7,9-10,13H2,1-5H3 |
| InChIKey | NLWWAMASGKNZTC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|