C26H41NO3 — CID 57244821
N-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(3-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]acetamide (PubChem CID 57244821) has the molecular formula C26H41NO3 and a molecular weight of 415.62 g/mol. Its IUPAC name is N-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(3-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]acetamide.
| Compound Name | N-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(3-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]acetamide |
|---|---|
| PubChem CID | 57244821 |
| Molecular Formula | C26H41NO3 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.31 |
| IUPAC Name | N-[(6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(3-methyloctan-2-yl)-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-9-yl]acetamide |
| SMILES | CCCCCC(C)C(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(NC(C)=O)C[C@@H]21 |
| InChI | InChI=1S/C26H41NO3/c1-7-8-9-10-16(2)17(3)19-13-23(29)25-21-15-20(27-18(4)28)11-12-22(21)26(5,6)30-24(25)14-19/h13-14,16-17,20-22,29H,7-12,15H2,1-6H3,(H,27,28)/t16?,17?,20?,21-,22-/m1/s1 |
| InChIKey | RWALKOXDSXOFOD-RSSYPFMNSA-N |
| XLogP | 6.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|