C18H24O5 — CID 58065044
(6aR,10aR)-1-hydroxy-3-(2-methoxyethoxy)-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one (PubChem CID 58065044) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (6aR,10aR)-1-hydroxy-3-(2-methoxyethoxy)-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one.
| Compound Name | (6aR,10aR)-1-hydroxy-3-(2-methoxyethoxy)-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
|---|---|
| PubChem CID | 58065044 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (6aR,10aR)-1-hydroxy-3-(2-methoxyethoxy)-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
| SMILES | COCCOc1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H24O5/c1-18(2)14-5-4-11(19)8-13(14)17-15(20)9-12(10-16(17)23-18)22-7-6-21-3/h9-10,13-14,20H,4-8H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | VGFHSBHEUFQASQ-ZIAGYGMSSA-N |
| XLogP | 3.04 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|