C21H26O3 — CID 54561141
(6aS,10aR)-3-cyclohex-2-en-1-yl-1-hydroxy-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one (PubChem CID 54561141) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (6aS,10aR)-3-cyclohex-2-en-1-yl-1-hydroxy-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one.
| Compound Name | (6aS,10aR)-3-cyclohex-2-en-1-yl-1-hydroxy-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
|---|---|
| PubChem CID | 54561141 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (6aS,10aR)-3-cyclohex-2-en-1-yl-1-hydroxy-6,6-dimethyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
| SMILES | CC1(C)Oc2cc(C3C=CCCC3)cc(O)c2[C@@H]2CC(=O)CC[C@@H]21 |
| InChI | InChI=1S/C21H26O3/c1-21(2)17-9-8-15(22)12-16(17)20-18(23)10-14(11-19(20)24-21)13-6-4-3-5-7-13/h4,6,10-11,13,16-17,23H,3,5,7-9,12H2,1-2H3/t13?,16-,17+/m1/s1 |
| InChIKey | ZQPZEUGNFDHSIZ-IIZJFRANSA-N |
| XLogP | 4.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|