C24H35FO2 — CID 90808602
1-fluoro-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one (PubChem CID 90808602) has the molecular formula C24H35FO2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 1-fluoro-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one.
| Compound Name | 1-fluoro-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
|---|---|
| PubChem CID | 90808602 |
| Molecular Formula | C24H35FO2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-fluoro-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
| SMILES | CCCCCCC(C)(C)c1cc(F)c2c(c1)OC(C)(C)C1CCC(=O)CC21 |
| InChI | InChI=1S/C24H35FO2/c1-6-7-8-9-12-23(2,3)16-13-20(25)22-18-15-17(26)10-11-19(18)24(4,5)27-21(22)14-16/h13-14,18-19H,6-12,15H2,1-5H3 |
| InChIKey | KJLXJSSLSFKBEY-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|