C32H49NO7 — CID 90376718
[(10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2-propylpentanoate (PubChem CID 90376718) has the molecular formula C32H49NO7 and a molecular weight of 559.74 g/mol. Its IUPAC name is [(10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2-propylpentanoate.
| Compound Name | [(10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2-propylpentanoate |
|---|---|
| PubChem CID | 90376718 |
| Molecular Formula | C32H49NO7 |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | [(10aR)-6,6-dimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)Oc1cc(C(C)(C)CCCCCCO[N+](=O)[O-])cc2c1[C@@H]1CC(=O)CCC1C(C)(C)O2 |
| InChI | InChI=1S/C32H49NO7/c1-7-13-22(14-8-2)30(35)39-27-19-23(31(3,4)17-11-9-10-12-18-38-33(36)37)20-28-29(27)25-21-24(34)15-16-26(25)32(5,6)40-28/h19-20,22,25-26H,7-18,21H2,1-6H3/t25-,26?/m1/s1 |
| InChIKey | PGSZJNZHPJQGTC-DCWQJPKNSA-N |
| XLogP | 7.87 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|