C28H37F2NO9 — CID 118620194
[5-[1,1-difluoro-2-(3-nitrooxypropoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenyl] 2-propylpentanoate (PubChem CID 118620194) has the molecular formula C28H37F2NO9 and a molecular weight of 569.60 g/mol. Its IUPAC name is [5-[1,1-difluoro-2-(3-nitrooxypropoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenyl] 2-propylpentanoate.
| Compound Name | [5-[1,1-difluoro-2-(3-nitrooxypropoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenyl] 2-propylpentanoate |
|---|---|
| PubChem CID | 118620194 |
| Molecular Formula | C28H37F2NO9 |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | [5-[1,1-difluoro-2-(3-nitrooxypropoxy)-2-oxoethyl]-2-[(1S,2S,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxyphenyl] 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)Oc1cc(C(F)(F)C(=O)OCCCO[N+](=O)[O-])cc(O)c1[C@H]1CC(=O)[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C28H37F2NO9/c1-5-8-16(9-6-2)25(34)40-23-13-17(28(29,30)26(35)38-10-7-11-39-31(36)37)12-22(33)24(23)18-14-21(32)20-15-19(18)27(20,3)4/h12-13,16,18-20,33H,5-11,14-15H2,1-4H3/t18-,19-,20+/m0/s1 |
| InChIKey | UWXPYXPJCPOTCH-SLFFLAALSA-N |
| XLogP | 5.47 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|