C24H33NO8 — CID 118620640
5-nitrooxypentyl 2-[4-[(1S,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2-methylpropanoate (PubChem CID 118620640) has the molecular formula C24H33NO8 and a molecular weight of 463.53 g/mol. Its IUPAC name is 5-nitrooxypentyl 2-[4-[(1S,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2-methylpropanoate.
| Compound Name | 5-nitrooxypentyl 2-[4-[(1S,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 118620640 |
| Molecular Formula | C24H33NO8 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 5-nitrooxypentyl 2-[4-[(1S,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-2-methylpropanoate |
| SMILES | CC(C)(C(=O)OCCCCCO[N+](=O)[O-])c1cc(O)c([C@@H]2CC(=O)[C@@H]3C[C@@H]2C3(C)C)c(O)c1 |
| InChI | InChI=1S/C24H33NO8/c1-23(2,22(29)32-8-6-5-7-9-33-25(30)31)14-10-19(27)21(20(28)11-14)15-12-18(26)17-13-16(15)24(17,3)4/h10-11,15-17,27-28H,5-9,12-13H2,1-4H3/t15-,16+,17+/m1/s1 |
| InChIKey | QQAYKFLBSCYPGE-IKGGRYGDSA-N |
| XLogP | 4.02 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|