C28H37NO7 — CID 118620591
2-[[3-[4-[(1S,2R,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-1-adamantyl]methoxy]ethyl nitrate (PubChem CID 118620591) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is 2-[[3-[4-[(1S,2R,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-1-adamantyl]methoxy]ethyl nitrate.
| Compound Name | 2-[[3-[4-[(1S,2R,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-1-adamantyl]methoxy]ethyl nitrate |
|---|---|
| PubChem CID | 118620591 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | 2-[[3-[4-[(1S,2R,5S)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3,5-dihydroxyphenyl]-1-adamantyl]methoxy]ethyl nitrate |
| SMILES | CC1(C)[C@@H]2C[C@H]1[C@H](c1c(O)cc(C34CC5CC(CC(COCCO[N+](=O)[O-])(C5)C3)C4)cc1O)CC2=O |
| InChI | InChI=1S/C28H37NO7/c1-26(2)20-9-21(26)22(30)8-19(20)25-23(31)6-18(7-24(25)32)28-12-16-5-17(13-28)11-27(10-16,14-28)15-35-3-4-36-29(33)34/h6-7,16-17,19-21,31-32H,3-5,8-15H2,1-2H3/t16?,17?,19-,20+,21-,27?,28?/m1/s1 |
| InChIKey | GVCMROOBPMVNGE-VAGQAXQQSA-N |
| XLogP | 4.88 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|