C26H42O3 — CID 142270105
(4S)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one;ethane (PubChem CID 142270105) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is (4S)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one;ethane.
| Compound Name | (4S)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one;ethane |
|---|---|
| PubChem CID | 142270105 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | (4S)-4-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethylbicyclo[3.1.1]heptan-2-one;ethane |
| SMILES | CC.CCCCCCC(C)(C)c1cc(O)c([C@H]2CC(=O)C3CC2C3(C)C)c(O)c1 |
| InChI | InChI=1S/C24H36O3.C2H6/c1-6-7-8-9-10-23(2,3)15-11-20(26)22(21(27)12-15)16-13-19(25)18-14-17(16)24(18,4)5;1-2/h11-12,16-18,26-27H,6-10,13-14H2,1-5H3;1-2H3/t16-,17?,18?;/m0./s1 |
| InChIKey | UICRUHGKTNFGEB-LQLXLQOXSA-N |
| XLogP | 7.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|