C25H38O4 — CID 53237275
3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 53237275) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | 3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 53237275 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CCCCCCC(C)(C)c1cc(O)c(C2CC3(C(=O)O)CCC2C3(C)C)c(O)c1 |
| InChI | InChI=1S/C25H38O4/c1-6-7-8-9-11-23(2,3)16-13-19(26)21(20(27)14-16)17-15-25(22(28)29)12-10-18(17)24(25,4)5/h13-14,17-18,26-27H,6-12,15H2,1-5H3,(H,28,29) |
| InChIKey | IYEXICSWWSVWAC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|