C25H39NO3 — CID 90128567
(1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexane-1-carboxamide (PubChem CID 90128567) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is (1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexane-1-carboxamide.
| Compound Name | (1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90128567 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | (1R,3R,4R)-3-[2,6-dihydroxy-4-(2-methyloctan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexane-1-carboxamide |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C(N)=O)C[C@H]1c1c(O)cc(C(C)(C)CCCCCC)cc1O |
| InChI | InChI=1S/C25H39NO3/c1-6-7-8-9-12-25(4,5)18-14-21(27)23(22(28)15-18)20-13-17(24(26)29)10-11-19(20)16(2)3/h14-15,17,19-20,27-28H,2,6-13H2,1,3-5H3,(H2,26,29)/t17-,19+,20-/m1/s1 |
| InChIKey | VBYAYZPTXRWWSQ-YZGWKJHDSA-N |
| XLogP | 5.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|