C26H37BrO4 — CID 144611255
[(3S)-3-[4-(7-bromo-2-methylheptan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate (PubChem CID 144611255) has the molecular formula C26H37BrO4 and a molecular weight of 493.48 g/mol. Its IUPAC name is [(3S)-3-[4-(7-bromo-2-methylheptan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S)-3-[4-(7-bromo-2-methylheptan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 144611255 |
| Molecular Formula | C26H37BrO4 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | [(3S)-3-[4-(7-bromo-2-methylheptan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
| SMILES | C=C(C)C1CCC(COC(C)=O)=C[C@@H]1c1c(O)cc(C(C)(C)CCCCCBr)cc1O |
| InChI | InChI=1S/C26H37BrO4/c1-17(2)21-10-9-19(16-31-18(3)28)13-22(21)25-23(29)14-20(15-24(25)30)26(4,5)11-7-6-8-12-27/h13-15,21-22,29-30H,1,6-12,16H2,2-5H3/t21?,22-/m0/s1 |
| InChIKey | GWZVACYBYSZLDL-KEKNWZKVSA-N |
| XLogP | 6.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|