C29H40O4 — CID 90128633
[(3S,4S)-3-[4-[1-[(Z)-hex-1-enyl]cyclopentyl]-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate (PubChem CID 90128633) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is [(3S,4S)-3-[4-[1-[(Z)-hex-1-enyl]cyclopentyl]-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S)-3-[4-[1-[(Z)-hex-1-enyl]cyclopentyl]-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 90128633 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | [(3S,4S)-3-[4-[1-[(Z)-hex-1-enyl]cyclopentyl]-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
| SMILES | C=C(C)[C@H]1CCC(COC(C)=O)=C[C@@H]1c1c(O)cc(C2(/C=C\CCCC)CCCC2)cc1O |
| InChI | InChI=1S/C29H40O4/c1-5-6-7-8-13-29(14-9-10-15-29)23-17-26(31)28(27(32)18-23)25-16-22(19-33-21(4)30)11-12-24(25)20(2)3/h8,13,16-18,24-25,31-32H,2,5-7,9-12,14-15,19H2,1,3-4H3/b13-8-/t24-,25+/m1/s1 |
| InChIKey | UYKACJGDZSRWPL-PHPKZAKRSA-N |
| XLogP | 7.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|