C26H37BrO3 — CID 123796369
5-[1-(5-bromopentyl)cyclopentyl]-2-[3-(hydroxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol (PubChem CID 123796369) has the molecular formula C26H37BrO3 and a molecular weight of 477.48 g/mol. Its IUPAC name is 5-[1-(5-bromopentyl)cyclopentyl]-2-[3-(hydroxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol.
| Compound Name | 5-[1-(5-bromopentyl)cyclopentyl]-2-[3-(hydroxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 123796369 |
| Molecular Formula | C26H37BrO3 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 5-[1-(5-bromopentyl)cyclopentyl]-2-[3-(hydroxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzene-1,3-diol |
| SMILES | C=C(C)C1CCC(CO)=CC1c1c(O)cc(C2(CCCCCBr)CCCC2)cc1O |
| InChI | InChI=1S/C26H37BrO3/c1-18(2)21-9-8-19(17-28)14-22(21)25-23(29)15-20(16-24(25)30)26(11-5-6-12-26)10-4-3-7-13-27/h14-16,21-22,28-30H,1,3-13,17H2,2H3 |
| InChIKey | OAXKOPAKDODGDP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|