C25H35BrO4 — CID 144611217
[(3S)-3-[4-(6-bromo-2-methylhexan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate (PubChem CID 144611217) has the molecular formula C25H35BrO4 and a molecular weight of 479.46 g/mol. Its IUPAC name is [(3S)-3-[4-(6-bromo-2-methylhexan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S)-3-[4-(6-bromo-2-methylhexan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 144611217 |
| Molecular Formula | C25H35BrO4 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [(3S)-3-[4-(6-bromo-2-methylhexan-2-yl)-2,6-dihydroxyphenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methyl acetate |
| SMILES | C=C(C)C1CCC(COC(C)=O)=C[C@@H]1c1c(O)cc(C(C)(C)CCCCBr)cc1O |
| InChI | InChI=1S/C25H35BrO4/c1-16(2)20-9-8-18(15-30-17(3)27)12-21(20)24-22(28)13-19(14-23(24)29)25(4,5)10-6-7-11-26/h12-14,20-21,28-29H,1,6-11,15H2,2-5H3/t20?,21-/m0/s1 |
| InChIKey | KMHQUSKSMWRRQU-LBAQZLPGSA-N |
| XLogP | 6.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|