C32H45NO10 — CID 118620202
hexyl 2-[4-[3-(acetyloxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-hydroxy-5-(4-nitrooxybutanoyloxy)phenyl]-2-methylpropanoate (PubChem CID 118620202) has the molecular formula C32H45NO10 and a molecular weight of 603.71 g/mol. Its IUPAC name is hexyl 2-[4-[3-(acetyloxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-hydroxy-5-(4-nitrooxybutanoyloxy)phenyl]-2-methylpropanoate.
| Compound Name | hexyl 2-[4-[3-(acetyloxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-hydroxy-5-(4-nitrooxybutanoyloxy)phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 118620202 |
| Molecular Formula | C32H45NO10 |
| Molecular Weight | 603.71 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | hexyl 2-[4-[3-(acetyloxymethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3-hydroxy-5-(4-nitrooxybutanoyloxy)phenyl]-2-methylpropanoate |
| SMILES | C=C(C)C1CCC(COC(C)=O)=CC1c1c(O)cc(C(C)(C)C(=O)OCCCCCC)cc1OC(=O)CCCO[N+](=O)[O-] |
| InChI | InChI=1S/C32H45NO10/c1-7-8-9-10-15-40-31(37)32(5,6)24-18-27(35)30(28(19-24)43-29(36)12-11-16-42-33(38)39)26-17-23(20-41-22(4)34)13-14-25(26)21(2)3/h17-19,25-26,35H,2,7-16,20H2,1,3-6H3 |
| InChIKey | SEODTTFYDMIASH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|