C27H39NO7 — CID 118620532
pentyl 2-[4-[(1R,2S,5S)-6,6-dimethyl-4-(nitrooxymethyl)-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]-2-methylpropanoate (PubChem CID 118620532) has the molecular formula C27H39NO7 and a molecular weight of 489.61 g/mol. Its IUPAC name is pentyl 2-[4-[(1R,2S,5S)-6,6-dimethyl-4-(nitrooxymethyl)-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]-2-methylpropanoate.
| Compound Name | pentyl 2-[4-[(1R,2S,5S)-6,6-dimethyl-4-(nitrooxymethyl)-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 118620532 |
| Molecular Formula | C27H39NO7 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | pentyl 2-[4-[(1R,2S,5S)-6,6-dimethyl-4-(nitrooxymethyl)-2-bicyclo[3.1.1]hept-3-enyl]-3,5-dimethoxyphenyl]-2-methylpropanoate |
| SMILES | CCCCCOC(=O)C(C)(C)c1cc(OC)c([C@H]2C=C(CO[N+](=O)[O-])[C@H]3C[C@H]2C3(C)C)c(OC)c1 |
| InChI | InChI=1S/C27H39NO7/c1-8-9-10-11-34-25(29)26(2,3)18-13-22(32-6)24(23(14-18)33-7)19-12-17(16-35-28(30)31)20-15-21(19)27(20,4)5/h12-14,19-21H,8-11,15-16H2,1-7H3/t19-,20+,21+/m0/s1 |
| InChIKey | KNKKHFMABWBBKD-PWRODBHTSA-N |
| XLogP | 5.61 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|