C28H43F3O3 — CID 176561114
[(5S)-4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol;fluoroform (PubChem CID 176561114) has the molecular formula C28H43F3O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is [(5S)-4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol;fluoroform.
| Compound Name | [(5S)-4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol;fluoroform |
|---|---|
| PubChem CID | 176561114 |
| Molecular Formula | C28H43F3O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [(5S)-4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methanol;fluoroform |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c(C2C=C(CO)C3C[C@@H]2C3(C)C)c(OC)c1.FC(F)F |
| InChI | InChI=1S/C27H42O3.CHF3/c1-8-9-10-11-12-26(2,3)19-14-23(29-6)25(24(15-19)30-7)20-13-18(17-28)21-16-22(20)27(21,4)5;2-1(3)4/h13-15,20-22,28H,8-12,16-17H2,1-7H3;1H/t20?,21?,22-;/m0./s1 |
| InChIKey | UVPGNQVARYQJIA-IHLBFOHUSA-N |
| XLogP | 7.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|