C26H38O3 — CID 143568824
[(2S,6S)-5-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-1-methyl-3-tricyclo[4.1.0.02,7]hept-3-enyl]methanol (PubChem CID 143568824) has the molecular formula C26H38O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is [(2S,6S)-5-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-1-methyl-3-tricyclo[4.1.0.02,7]hept-3-enyl]methanol.
| Compound Name | [(2S,6S)-5-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-1-methyl-3-tricyclo[4.1.0.02,7]hept-3-enyl]methanol |
|---|---|
| PubChem CID | 143568824 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | [(2S,6S)-5-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-1-methyl-3-tricyclo[4.1.0.02,7]hept-3-enyl]methanol |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c(C2C=C(CO)[C@H]3C4C2C43C)c(OC)c1 |
| InChI | InChI=1S/C26H38O3/c1-7-8-9-10-11-25(2,3)17-13-19(28-5)21(20(14-17)29-6)18-12-16(15-27)22-24-23(18)26(22,24)4/h12-14,18,22-24,27H,7-11,15H2,1-6H3/t18?,22-,23?,24?,26?/m0/s1 |
| InChIKey | GASRXTMEIYQRQF-FSZBAKPPSA-N |
| XLogP | 5.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|