C27H42O3 — CID 66937893
cis-(2S,3S)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidene-3-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 66937893) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is cis-(2S,3S)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidene-3-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | cis-(2S,3S)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidene-3-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 66937893 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | cis-(2S,3S)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidene-3-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C1CC[C@H](C(=C)C)[C@@H](c2c(OC)cc(C(C)(C)CCCCCC)cc2OC)C1O |
| InChI | InChI=1S/C27H42O3/c1-9-10-11-12-15-27(5,6)20-16-22(29-7)25(23(17-20)30-8)24-21(18(2)3)14-13-19(4)26(24)28/h16-17,21,24,26,28H,2,4,9-15H2,1,3,5-8H3/t21-,24+,26?/m1/s1 |
| InChIKey | SAEVAWZWVWJAPG-LTWQYWIZSA-N |
| XLogP | 6.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|