C29H45NO4 — CID 90128586
[(3S,4S)-3-[2,6-dimethoxy-4-(2-methyl-6-morpholin-4-ylhexan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methanol (PubChem CID 90128586) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is [(3S,4S)-3-[2,6-dimethoxy-4-(2-methyl-6-morpholin-4-ylhexan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methanol.
| Compound Name | [(3S,4S)-3-[2,6-dimethoxy-4-(2-methyl-6-morpholin-4-ylhexan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 90128586 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | [(3S,4S)-3-[2,6-dimethoxy-4-(2-methyl-6-morpholin-4-ylhexan-2-yl)phenyl]-4-prop-1-en-2-ylcyclohexen-1-yl]methanol |
| SMILES | C=C(C)[C@H]1CCC(CO)=C[C@@H]1c1c(OC)cc(C(C)(C)CCCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C29H45NO4/c1-21(2)24-10-9-22(20-31)17-25(24)28-26(32-5)18-23(19-27(28)33-6)29(3,4)11-7-8-12-30-13-15-34-16-14-30/h17-19,24-25,31H,1,7-16,20H2,2-6H3/t24-,25+/m1/s1 |
| InChIKey | CDNNDJNJQQDHDB-RPBOFIJWSA-N |
| XLogP | 5.47 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|