C28H39NO4 — CID 155448258
(E)-3-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]-1-morpholin-4-ylprop-2-en-1-one (PubChem CID 155448258) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is (E)-3-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]-1-morpholin-4-ylprop-2-en-1-one.
| Compound Name | (E)-3-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]-1-morpholin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 155448258 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | (E)-3-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]-1-morpholin-4-ylprop-2-en-1-one |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1O/C=C/C(=O)N1CCOCC1 |
| InChI | InChI=1S/C28H39NO4/c1-5-6-7-8-22-18-25(30)28(24-17-21(4)9-10-23(24)20(2)3)26(19-22)33-14-11-27(31)29-12-15-32-16-13-29/h11,14,17-19,23-24,30H,2,5-10,12-13,15-16H2,1,3-4H3/b14-11+/t23-,24+/m0/s1 |
| InChIKey | XFWAJYHCZNAPHD-BDPQSKBNSA-N |
| XLogP | 5.89 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|