C19H31NO3 — CID 164538922
4-[5-(3,5-dimethoxyphenyl)-5-methylhexyl]morpholine (PubChem CID 164538922) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 4-[5-(3,5-dimethoxyphenyl)-5-methylhexyl]morpholine.
| Compound Name | 4-[5-(3,5-dimethoxyphenyl)-5-methylhexyl]morpholine |
|---|---|
| PubChem CID | 164538922 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 4-[5-(3,5-dimethoxyphenyl)-5-methylhexyl]morpholine |
| SMILES | COc1cc(OC)cc(C(C)(C)CCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C19H31NO3/c1-19(2,7-5-6-8-20-9-11-23-12-10-20)16-13-17(21-3)15-18(14-16)22-4/h13-15H,5-12H2,1-4H3 |
| InChIKey | KJSNWCPOXNCLIG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|