C26H40O4 — CID 66937738
[(2R)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidenecyclohexyl] acetate (PubChem CID 66937738) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is [(2R)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidenecyclohexyl] acetate.
| Compound Name | [(2R)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 66937738 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | [(2R)-2-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]-6-methylidenecyclohexyl] acetate |
| SMILES | C=C1CCC[C@H](c2c(OC)cc(C(C)(C)CCCCCC)cc2OC)C1OC(C)=O |
| InChI | InChI=1S/C26H40O4/c1-8-9-10-11-15-26(4,5)20-16-22(28-6)24(23(17-20)29-7)21-14-12-13-18(2)25(21)30-19(3)27/h16-17,21,25H,2,8-15H2,1,3-7H3/t21-,25?/m1/s1 |
| InChIKey | PSUUANWNGUAUIO-JGKWMGOWSA-N |
| XLogP | 6.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|