C23H34O3 — CID 58803986
4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]cyclohex-3-en-1-one (PubChem CID 58803986) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]cyclohex-3-en-1-one.
| Compound Name | 4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 58803986 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 4-[2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl]cyclohex-3-en-1-one |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c(C2=CCC(=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C23H34O3/c1-6-7-8-9-14-23(2,3)18-15-20(25-4)22(21(16-18)26-5)17-10-12-19(24)13-11-17/h10,15-16H,6-9,11-14H2,1-5H3 |
| InChIKey | LOOZYPWYPUZCCT-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|