C24H36O2 — CID 141162074
9-methoxy-1,1-dimethyl-7-(2-methyloctan-2-yl)-3,4-dihydro-2H-dibenzofuran (PubChem CID 141162074) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 9-methoxy-1,1-dimethyl-7-(2-methyloctan-2-yl)-3,4-dihydro-2H-dibenzofuran.
| Compound Name | 9-methoxy-1,1-dimethyl-7-(2-methyloctan-2-yl)-3,4-dihydro-2H-dibenzofuran |
|---|---|
| PubChem CID | 141162074 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 9-methoxy-1,1-dimethyl-7-(2-methyloctan-2-yl)-3,4-dihydro-2H-dibenzofuran |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c2c3c(oc2c1)CCCC3(C)C |
| InChI | InChI=1S/C24H36O2/c1-7-8-9-10-13-23(2,3)17-15-19(25-6)21-20(16-17)26-18-12-11-14-24(4,5)22(18)21/h15-16H,7-14H2,1-6H3 |
| InChIKey | LFEPFDYMCOCXJB-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|