C27H34O4 — CID 70678098
5-methoxy-3-[(2-methoxyphenyl)methyl]-7-(2-methyloctan-2-yl)chromen-2-one (PubChem CID 70678098) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-methoxy-3-[(2-methoxyphenyl)methyl]-7-(2-methyloctan-2-yl)chromen-2-one.
| Compound Name | 5-methoxy-3-[(2-methoxyphenyl)methyl]-7-(2-methyloctan-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 70678098 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 5-methoxy-3-[(2-methoxyphenyl)methyl]-7-(2-methyloctan-2-yl)chromen-2-one |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c2cc(Cc3ccccc3OC)c(=O)oc2c1 |
| InChI | InChI=1S/C27H34O4/c1-6-7-8-11-14-27(2,3)21-17-24(30-5)22-16-20(26(28)31-25(22)18-21)15-19-12-9-10-13-23(19)29-4/h9-10,12-13,16-18H,6-8,11,14-15H2,1-5H3 |
| InChIKey | LLUZGJRVXAFKKI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|