C26H32O3 — CID 70677959
3-benzyl-5-methoxy-7-(2-methyloctan-2-yl)chromen-2-one (PubChem CID 70677959) has the molecular formula C26H32O3 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-benzyl-5-methoxy-7-(2-methyloctan-2-yl)chromen-2-one.
| Compound Name | 3-benzyl-5-methoxy-7-(2-methyloctan-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 70677959 |
| Molecular Formula | C26H32O3 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 3-benzyl-5-methoxy-7-(2-methyloctan-2-yl)chromen-2-one |
| SMILES | CCCCCCC(C)(C)c1cc(OC)c2cc(Cc3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C26H32O3/c1-5-6-7-11-14-26(2,3)21-17-23(28-4)22-16-20(25(27)29-24(22)18-21)15-19-12-9-8-10-13-19/h8-10,12-13,16-18H,5-7,11,14-15H2,1-4H3 |
| InChIKey | XGVMJRRAQJNWAN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|