C15H23ClO3S — CID 54418079
2-methoxy-5-(2-methylheptan-2-yl)benzenesulfonyl chloride (PubChem CID 54418079) has the molecular formula C15H23ClO3S and a molecular weight of 318.87 g/mol. Its IUPAC name is 2-methoxy-5-(2-methylheptan-2-yl)benzenesulfonyl chloride.
| Compound Name | 2-methoxy-5-(2-methylheptan-2-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 54418079 |
| Molecular Formula | C15H23ClO3S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-methoxy-5-(2-methylheptan-2-yl)benzenesulfonyl chloride |
| SMILES | CCCCCC(C)(C)c1ccc(OC)c(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C15H23ClO3S/c1-5-6-7-10-15(2,3)12-8-9-13(19-4)14(11-12)20(16,17)18/h8-9,11H,5-7,10H2,1-4H3 |
| InChIKey | VYVSBMBNAZWFBN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|