C22H35ClO4S — CID 139633642
2-[2-butoxy-5-(2-methylheptan-2-yl)phenyl]sulfonylbutanoyl chloride (PubChem CID 139633642) has the molecular formula C22H35ClO4S and a molecular weight of 431.04 g/mol. Its IUPAC name is 2-[2-butoxy-5-(2-methylheptan-2-yl)phenyl]sulfonylbutanoyl chloride.
| Compound Name | 2-[2-butoxy-5-(2-methylheptan-2-yl)phenyl]sulfonylbutanoyl chloride |
|---|---|
| PubChem CID | 139633642 |
| Molecular Formula | C22H35ClO4S |
| Molecular Weight | 431.04 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[2-butoxy-5-(2-methylheptan-2-yl)phenyl]sulfonylbutanoyl chloride |
| SMILES | CCCCCC(C)(C)c1ccc(OCCCC)c(S(=O)(=O)C(CC)C(=O)Cl)c1 |
| InChI | InChI=1S/C22H35ClO4S/c1-6-9-11-14-22(4,5)17-12-13-18(27-15-10-7-2)20(16-17)28(25,26)19(8-3)21(23)24/h12-13,16,19H,6-11,14-15H2,1-5H3 |
| InChIKey | FKZQUDQJSHCBFR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.04 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|