C25H43NO4S — CID 54107930
5-(2-methylheptan-2-yl)-2-octoxy-N-(1-oxopropan-2-yl)benzenesulfonamide (PubChem CID 54107930) has the molecular formula C25H43NO4S and a molecular weight of 453.69 g/mol. Its IUPAC name is 5-(2-methylheptan-2-yl)-2-octoxy-N-(1-oxopropan-2-yl)benzenesulfonamide.
| Compound Name | 5-(2-methylheptan-2-yl)-2-octoxy-N-(1-oxopropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 54107930 |
| Molecular Formula | C25H43NO4S |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 5-(2-methylheptan-2-yl)-2-octoxy-N-(1-oxopropan-2-yl)benzenesulfonamide |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)CCCCC)cc1S(=O)(=O)NC(C)C=O |
| InChI | InChI=1S/C25H43NO4S/c1-6-8-10-11-12-14-18-30-23-16-15-22(25(4,5)17-13-9-7-2)19-24(23)31(28,29)26-21(3)20-27/h15-16,19-21,26H,6-14,17-18H2,1-5H3 |
| InChIKey | JFKXUXUHAIXQOD-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|