C22H37ClO3S — CID 86184522
2-octoxy-5-(2,3,4-trimethylpentan-2-yl)benzenesulfonyl chloride (PubChem CID 86184522) has the molecular formula C22H37ClO3S and a molecular weight of 417.06 g/mol. Its IUPAC name is 2-octoxy-5-(2,3,4-trimethylpentan-2-yl)benzenesulfonyl chloride.
| Compound Name | 2-octoxy-5-(2,3,4-trimethylpentan-2-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 86184522 |
| Molecular Formula | C22H37ClO3S |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-octoxy-5-(2,3,4-trimethylpentan-2-yl)benzenesulfonyl chloride |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)C(C)C(C)C)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C22H37ClO3S/c1-7-8-9-10-11-12-15-26-20-14-13-19(16-21(20)27(23,24)25)22(5,6)18(4)17(2)3/h13-14,16-18H,7-12,15H2,1-6H3 |
| InChIKey | GQXSYIINBDURNR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|