C24H42NNaO5S2 — CID 23680989
sodium 2-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylamino]ethanesulfinate (PubChem CID 23680989) has the molecular formula C24H42NNaO5S2 and a molecular weight of 511.73 g/mol. Its IUPAC name is sodium 2-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylamino]ethanesulfinate.
| Compound Name | sodium 2-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylamino]ethanesulfinate |
|---|---|
| PubChem CID | 23680989 |
| Molecular Formula | C24H42NNaO5S2 |
| Molecular Weight | 511.73 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | sodium 2-[[2-octoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylamino]ethanesulfinate |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)CC(C)(C)C)cc1S(=O)(=O)NCCS(=O)[O-].[Na+] |
| InChI | InChI=1S/C24H43NO5S2.Na/c1-7-8-9-10-11-12-16-30-21-14-13-20(24(5,6)19-23(2,3)4)18-22(21)32(28,29)25-15-17-31(26)27;/h13-14,18,25H,7-12,15-17,19H2,1-6H3,(H,26,27);/q;+1/p-1 |
| InChIKey | DFBUISNOHCZGLG-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|