C26H46NO4S- — CID 57114329
2-[1-[hydroxy(sulfinato)amino]-2-methylpropyl]-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene (PubChem CID 57114329) has the molecular formula C26H46NO4S- and a molecular weight of 468.72 g/mol. Its IUPAC name is 2-[1-[hydroxy(sulfinato)amino]-2-methylpropyl]-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene.
| Compound Name | 2-[1-[hydroxy(sulfinato)amino]-2-methylpropyl]-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
|---|---|
| PubChem CID | 57114329 |
| Molecular Formula | C26H46NO4S- |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 2-[1-[hydroxy(sulfinato)amino]-2-methylpropyl]-1-octoxy-4-(2,4,4-trimethylpentan-2-yl)benzene |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)CC(C)(C)C)cc1C(C(C)C)N(O)S(=O)[O-] |
| InChI | InChI=1S/C26H47NO4S/c1-9-10-11-12-13-14-17-31-23-16-15-21(26(7,8)19-25(4,5)6)18-22(23)24(20(2)3)27(28)32(29)30/h15-16,18,20,24,28H,9-14,17,19H2,1-8H3,(H,29,30)/p-1 |
| InChIKey | UILWKSJOMSSQDO-UHFFFAOYSA-M |
| XLogP | 7.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|