C22H38O3S — CID 23505386
2-octoxy-6-(2,4,4-trimethylpentan-2-yl)benzenesulfinic acid (PubChem CID 23505386) has the molecular formula C22H38O3S and a molecular weight of 382.61 g/mol. Its IUPAC name is 2-octoxy-6-(2,4,4-trimethylpentan-2-yl)benzenesulfinic acid.
| Compound Name | 2-octoxy-6-(2,4,4-trimethylpentan-2-yl)benzenesulfinic acid |
|---|---|
| PubChem CID | 23505386 |
| Molecular Formula | C22H38O3S |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 2-octoxy-6-(2,4,4-trimethylpentan-2-yl)benzenesulfinic acid |
| SMILES | CCCCCCCCOc1cccc(C(C)(C)CC(C)(C)C)c1S(=O)O |
| InChI | InChI=1S/C22H38O3S/c1-7-8-9-10-11-12-16-25-19-15-13-14-18(20(19)26(23)24)22(5,6)17-21(2,3)4/h13-15H,7-12,16-17H2,1-6H3,(H,23,24) |
| InChIKey | IEAPOJLFVRSBSK-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|