C22H36O5S — CID 53439952
4-[2-butoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylbutanoic acid (PubChem CID 53439952) has the molecular formula C22H36O5S and a molecular weight of 412.59 g/mol. Its IUPAC name is 4-[2-butoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylbutanoic acid.
| Compound Name | 4-[2-butoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylbutanoic acid |
|---|---|
| PubChem CID | 53439952 |
| Molecular Formula | C22H36O5S |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-[2-butoxy-5-(2,4,4-trimethylpentan-2-yl)phenyl]sulfonylbutanoic acid |
| SMILES | CCCCOc1ccc(C(C)(C)CC(C)(C)C)cc1S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C22H36O5S/c1-7-8-13-27-18-12-11-17(22(5,6)16-21(2,3)4)15-19(18)28(25,26)14-9-10-20(23)24/h11-12,15H,7-10,13-14,16H2,1-6H3,(H,23,24) |
| InChIKey | GTBGEMROQNJPQD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|