C39H66N2O6S2 — CID 54011921
5-(2-methylheptan-2-yl)-2-octoxy-N-[4-octoxy-3-(propylsulfamoyl)phenyl]benzenesulfonamide (PubChem CID 54011921) has the molecular formula C39H66N2O6S2 and a molecular weight of 723.10 g/mol. Its IUPAC name is 5-(2-methylheptan-2-yl)-2-octoxy-N-[4-octoxy-3-(propylsulfamoyl)phenyl]benzenesulfonamide.
| Compound Name | 5-(2-methylheptan-2-yl)-2-octoxy-N-[4-octoxy-3-(propylsulfamoyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54011921 |
| Molecular Formula | C39H66N2O6S2 |
| Molecular Weight | 723.10 g/mol |
| Exact Mass | 722.44 |
| IUPAC Name | 5-(2-methylheptan-2-yl)-2-octoxy-N-[4-octoxy-3-(propylsulfamoyl)phenyl]benzenesulfonamide |
| SMILES | CCCCCCCCOc1ccc(NS(=O)(=O)c2cc(C(C)(C)CCCCC)ccc2OCCCCCCCC)cc1S(=O)(=O)NCCC |
| InChI | InChI=1S/C39H66N2O6S2/c1-7-11-14-16-18-21-29-46-35-25-23-33(39(5,6)27-20-13-9-3)31-37(35)49(44,45)41-34-24-26-36(47-30-22-19-17-15-12-8-2)38(32-34)48(42,43)40-28-10-4/h23-26,31-32,40-41H,7-22,27-30H2,1-6H3 |
| InChIKey | BYDNLNAIOLRSON-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.10 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|