C20H27NO3S — CID 16645088
N-(3,5-dimethylphenyl)-4-methyl-2-pentoxybenzenesulfonamide (PubChem CID 16645088) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-methyl-2-pentoxybenzenesulfonamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-methyl-2-pentoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16645088 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-methyl-2-pentoxybenzenesulfonamide |
| SMILES | CCCCCOc1cc(C)ccc1S(=O)(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H27NO3S/c1-5-6-7-10-24-19-14-15(2)8-9-20(19)25(22,23)21-18-12-16(3)11-17(4)13-18/h8-9,11-14,21H,5-7,10H2,1-4H3 |
| InChIKey | MJBABMLSAGHDOU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|