C45H74O3 — CID 141011315
bis[2,4-bis(2-methylheptan-2-yl)phenyl] carbonate (PubChem CID 141011315) has the molecular formula C45H74O3 and a molecular weight of 663.08 g/mol. Its IUPAC name is bis[2,4-bis(2-methylheptan-2-yl)phenyl] carbonate.
| Compound Name | bis[2,4-bis(2-methylheptan-2-yl)phenyl] carbonate |
|---|---|
| PubChem CID | 141011315 |
| Molecular Formula | C45H74O3 |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 662.56 |
| IUPAC Name | bis[2,4-bis(2-methylheptan-2-yl)phenyl] carbonate |
| SMILES | CCCCCC(C)(C)c1ccc(OC(=O)Oc2ccc(C(C)(C)CCCCC)cc2C(C)(C)CCCCC)c(C(C)(C)CCCCC)c1 |
| InChI | InChI=1S/C45H74O3/c1-13-17-21-29-42(5,6)35-25-27-39(37(33-35)44(9,10)31-23-19-15-3)47-41(46)48-40-28-26-36(43(7,8)30-22-18-14-2)34-38(40)45(11,12)32-24-20-16-4/h25-28,33-34H,13-24,29-32H2,1-12H3 |
| InChIKey | GKBXFGWVYJVNON-UHFFFAOYSA-N |
| XLogP | 14.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 14.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|