C18H26O6 — CID 59544142
[4-tert-butyl-2-(1-methoxycarbonyloxy-2-methylpropan-2-yl)phenyl] methyl carbonate (PubChem CID 59544142) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is [4-tert-butyl-2-(1-methoxycarbonyloxy-2-methylpropan-2-yl)phenyl] methyl carbonate.
| Compound Name | [4-tert-butyl-2-(1-methoxycarbonyloxy-2-methylpropan-2-yl)phenyl] methyl carbonate |
|---|---|
| PubChem CID | 59544142 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [4-tert-butyl-2-(1-methoxycarbonyloxy-2-methylpropan-2-yl)phenyl] methyl carbonate |
| SMILES | COC(=O)OCC(C)(C)c1cc(C(C)(C)C)ccc1OC(=O)OC |
| InChI | InChI=1S/C18H26O6/c1-17(2,3)12-8-9-14(24-16(20)22-7)13(10-12)18(4,5)11-23-15(19)21-6/h8-10H,11H2,1-7H3 |
| InChIKey | ZUWYNTJWMPTUGB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|