C37H60N2O3 — CID 23129318
2-[2,4-bis(2-methylheptan-2-yl)phenoxy]-N-(5-ethyl-3-hydroxy-2-pyridinyl)octanamide (PubChem CID 23129318) has the molecular formula C37H60N2O3 and a molecular weight of 580.90 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylheptan-2-yl)phenoxy]-N-(5-ethyl-3-hydroxy-2-pyridinyl)octanamide.
| Compound Name | 2-[2,4-bis(2-methylheptan-2-yl)phenoxy]-N-(5-ethyl-3-hydroxy-2-pyridinyl)octanamide |
|---|---|
| PubChem CID | 23129318 |
| Molecular Formula | C37H60N2O3 |
| Molecular Weight | 580.90 g/mol |
| Exact Mass | 580.46 |
| IUPAC Name | 2-[2,4-bis(2-methylheptan-2-yl)phenoxy]-N-(5-ethyl-3-hydroxy-2-pyridinyl)octanamide |
| SMILES | CCCCCCC(Oc1ccc(C(C)(C)CCCCC)cc1C(C)(C)CCCCC)C(=O)Nc1ncc(CC)cc1O |
| InChI | InChI=1S/C37H60N2O3/c1-9-13-16-17-20-33(35(41)39-34-31(40)25-28(12-4)27-38-34)42-32-22-21-29(36(5,6)23-18-14-10-2)26-30(32)37(7,8)24-19-15-11-3/h21-22,25-27,33,40H,9-20,23-24H2,1-8H3,(H,38,39,41) |
| InChIKey | FPBLAHZFZBTCNO-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.90 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|