C23H38O3 — CID 54082912
methyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoate (PubChem CID 54082912) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is methyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoate.
| Compound Name | methyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoate |
|---|---|
| PubChem CID | 54082912 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | methyl 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]hexanoate |
| SMILES | CCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)OC |
| InChI | InChI=1S/C23H38O3/c1-9-12-13-20(21(24)25-8)26-19-15-14-17(22(4,5)10-2)16-18(19)23(6,7)11-3/h14-16,20H,9-13H2,1-8H3 |
| InChIKey | MOJLUNBVLLGVAT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |