C23H37ClO2 — CID 56606464
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-ethylpentanoyl chloride (PubChem CID 56606464) has the molecular formula C23H37ClO2 and a molecular weight of 381.00 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-ethylpentanoyl chloride.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-ethylpentanoyl chloride |
|---|---|
| PubChem CID | 56606464 |
| Molecular Formula | C23H37ClO2 |
| Molecular Weight | 381.00 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-3-ethylpentanoyl chloride |
| SMILES | CCC(CC)C(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Cl |
| InChI | InChI=1S/C23H37ClO2/c1-9-16(10-2)20(21(24)25)26-19-14-13-17(22(5,6)11-3)15-18(19)23(7,8)12-4/h13-16,20H,9-12H2,1-8H3 |
| InChIKey | DQKOHAGPBXPBAH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.00 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|