C26H36ClNO3 — CID 57239890
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-chlorophenyl)-N-hydroxybutanamide (PubChem CID 57239890) has the molecular formula C26H36ClNO3 and a molecular weight of 446.03 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-chlorophenyl)-N-hydroxybutanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-chlorophenyl)-N-hydroxybutanamide |
|---|---|
| PubChem CID | 57239890 |
| Molecular Formula | C26H36ClNO3 |
| Molecular Weight | 446.03 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(4-chlorophenyl)-N-hydroxybutanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)N(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H36ClNO3/c1-8-22(24(29)28(30)20-14-12-19(27)13-15-20)31-23-16-11-18(25(4,5)9-2)17-21(23)26(6,7)10-3/h11-17,22,30H,8-10H2,1-7H3 |
| InChIKey | XDLKEBIYLFYVMN-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.03 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|