C28H37ClN2O3S — CID 21426824
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(3-chloro-2-hydroxy-5-isothiocyanato-4-methylphenyl)butanamide (PubChem CID 21426824) has the molecular formula C28H37ClN2O3S and a molecular weight of 517.14 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(3-chloro-2-hydroxy-5-isothiocyanato-4-methylphenyl)butanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(3-chloro-2-hydroxy-5-isothiocyanato-4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 21426824 |
| Molecular Formula | C28H37ClN2O3S |
| Molecular Weight | 517.14 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-(3-chloro-2-hydroxy-5-isothiocyanato-4-methylphenyl)butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cc(N=C=S)c(C)c(Cl)c1O |
| InChI | InChI=1S/C28H37ClN2O3S/c1-9-22(26(33)31-21-15-20(30-16-35)17(4)24(29)25(21)32)34-23-13-12-18(27(5,6)10-2)14-19(23)28(7,8)11-3/h12-15,22,32H,9-11H2,1-8H3,(H,31,33) |
| InChIKey | ASIYRADYWPMOSB-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.14 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|