C31H39ClF5N3O5 — CID 102370757
N-[4-acetamido-5-chloro-2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide (PubChem CID 102370757) has the molecular formula C31H39ClF5N3O5 and a molecular weight of 664.11 g/mol. Its IUPAC name is N-[4-acetamido-5-chloro-2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide.
| Compound Name | N-[4-acetamido-5-chloro-2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 102370757 |
| Molecular Formula | C31H39ClF5N3O5 |
| Molecular Weight | 664.11 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | N-[4-acetamido-5-chloro-2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)phenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cc(Cl)c(NC(C)=O)c(NC(=O)C(F)(F)C(F)(F)F)c1O |
| InChI | InChI=1S/C31H39ClF5N3O5/c1-9-21(45-22-13-12-17(28(5,6)10-2)14-18(22)29(7,8)11-3)26(43)39-20-15-19(32)23(38-16(4)41)24(25(20)42)40-27(44)30(33,34)31(35,36)37/h12-15,21,42H,9-11H2,1-8H3,(H,38,41)(H,39,43)(H,40,44) |
| InChIKey | VZQJQOVJQXRJMI-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.11 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|